C23H35NO — CID 143795595
2,4-ditert-butyl-6-[[[(4S)-4,6-dimethylcyclohexa-1,5-dien-1-yl]amino]methyl]phenol (PubChem CID 143795595) has the molecular formula C23H35NO and a molecular weight of 341.54 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[[(4S)-4,6-dimethylcyclohexa-1,5-dien-1-yl]amino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[[(4S)-4,6-dimethylcyclohexa-1,5-dien-1-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 143795595 |
| Molecular Formula | C23H35NO |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | 2,4-ditert-butyl-6-[[[(4S)-4,6-dimethylcyclohexa-1,5-dien-1-yl]amino]methyl]phenol |
| SMILES | CC1=C[C@@H](C)CC=C1NCc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H35NO/c1-15-9-10-20(16(2)11-15)24-14-17-12-18(22(3,4)5)13-19(21(17)25)23(6,7)8/h10-13,15,24-25H,9,14H2,1-8H3/t15-/m0/s1 |
| InChIKey | YFQJMPVWCITXKV-HNNXBMFYSA-N |
| XLogP | 5.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|