C37H52O3 — CID 19352850
2,6-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4-methylphenol (PubChem CID 19352850) has the molecular formula C37H52O3 and a molecular weight of 544.82 g/mol. Its IUPAC name is 2,6-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4-methylphenol.
| Compound Name | 2,6-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4-methylphenol |
|---|---|
| PubChem CID | 19352850 |
| Molecular Formula | C37H52O3 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.39 |
| IUPAC Name | 2,6-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4-methylphenol |
| SMILES | Cc1cc(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c1 |
| InChI | InChI=1S/C37H52O3/c1-22-14-23(16-25-18-27(34(2,3)4)20-29(32(25)39)36(8,9)10)31(38)24(15-22)17-26-19-28(35(5,6)7)21-30(33(26)40)37(11,12)13/h14-15,18-21,38-40H,16-17H2,1-13H3 |
| InChIKey | IFXQOHKIFOXERR-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |