C25H36O — CID 11792333
2,4-ditert-butyl-6-[(4-tert-butylphenyl)methyl]phenol (PubChem CID 11792333) has the molecular formula C25H36O and a molecular weight of 352.56 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(4-tert-butylphenyl)methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(4-tert-butylphenyl)methyl]phenol |
|---|---|
| PubChem CID | 11792333 |
| Molecular Formula | C25H36O |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | 2,4-ditert-butyl-6-[(4-tert-butylphenyl)methyl]phenol |
| SMILES | CC(C)(C)c1ccc(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)cc1 |
| InChI | InChI=1S/C25H36O/c1-23(2,3)19-12-10-17(11-13-19)14-18-15-20(24(4,5)6)16-21(22(18)26)25(7,8)9/h10-13,15-16,26H,14H2,1-9H3 |
| InChIKey | ASEUJIZWBPDSNG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |