C28H39ClO3 — CID 156861647
3-[3-tert-butyl-5-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4-hydroxyphenyl]propanoyl chloride (PubChem CID 156861647) has the molecular formula C28H39ClO3 and a molecular weight of 459.07 g/mol. Its IUPAC name is 3-[3-tert-butyl-5-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4-hydroxyphenyl]propanoyl chloride.
| Compound Name | 3-[3-tert-butyl-5-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4-hydroxyphenyl]propanoyl chloride |
|---|---|
| PubChem CID | 156861647 |
| Molecular Formula | C28H39ClO3 |
| Molecular Weight | 459.07 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 3-[3-tert-butyl-5-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4-hydroxyphenyl]propanoyl chloride |
| SMILES | CC(C)(C)c1cc(Cc2cc(CCC(=O)Cl)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H39ClO3/c1-26(2,3)20-15-19(25(32)22(16-20)28(7,8)9)14-18-12-17(10-11-23(29)30)13-21(24(18)31)27(4,5)6/h12-13,15-16,31-32H,10-11,14H2,1-9H3 |
| InChIKey | BFTVLJLQGVJILM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.07 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|