C23H32O2 — CID 139625941
2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-dimethylphenol (PubChem CID 139625941) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-dimethylphenol.
| Compound Name | 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 139625941 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c1 |
| InChI | InChI=1S/C23H32O2/c1-14-9-15(2)20(24)16(10-14)11-17-12-18(22(3,4)5)13-19(21(17)25)23(6,7)8/h9-10,12-13,24-25H,11H2,1-8H3 |
| InChIKey | ZSMRPVPUNWZJTN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |