C24H26O4 — CID 58625699
2,5-bis[(2-hydroxy-3,5-dimethylphenyl)methyl]benzene-1,4-diol (PubChem CID 58625699) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2,5-bis[(2-hydroxy-3,5-dimethylphenyl)methyl]benzene-1,4-diol.
| Compound Name | 2,5-bis[(2-hydroxy-3,5-dimethylphenyl)methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 58625699 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2,5-bis[(2-hydroxy-3,5-dimethylphenyl)methyl]benzene-1,4-diol |
| SMILES | Cc1cc(C)c(O)c(Cc2cc(O)c(Cc3cc(C)cc(C)c3O)cc2O)c1 |
| InChI | InChI=1S/C24H26O4/c1-13-5-15(3)23(27)19(7-13)9-17-11-22(26)18(12-21(17)25)10-20-8-14(2)6-16(4)24(20)28/h5-8,11-12,25-28H,9-10H2,1-4H3 |
| InChIKey | VLCOQUUCFXJXPH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|