C10H14O — CID 102175536
2-(1,2-13C2)ethyl-4,6-dimethylphenol (PubChem CID 102175536) has the molecular formula C10H14O and a molecular weight of 152.21 g/mol. Its IUPAC name is 2-(1,2-13C2)ethyl-4,6-dimethylphenol.
| Compound Name | 2-(1,2-13C2)ethyl-4,6-dimethylphenol |
|---|---|
| PubChem CID | 102175536 |
| Molecular Formula | C10H14O |
| Molecular Weight | 152.21 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 2-(1,2-13C2)ethyl-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c([13CH2][13CH3])c1 |
| InChI | InChI=1S/C10H14O/c1-4-9-6-7(2)5-8(3)10(9)11/h5-6,11H,4H2,1-3H3/i1+1,4+1 |
| InChIKey | MXHAHSBTOVFDBK-VFZPYAPFSA-N |
| XLogP | 2.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |