C17H20O2 — CID 21282731
2-[(4-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenol (PubChem CID 21282731) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-[(4-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenol.
| Compound Name | 2-[(4-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 21282731 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-[(4-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(Cc2cc(C)c(O)c(C)c2)c1 |
| InChI | InChI=1S/C17H20O2/c1-10-5-11(2)17(19)15(6-10)9-14-7-12(3)16(18)13(4)8-14/h5-8,18-19H,9H2,1-4H3 |
| InChIKey | SSPFZCYHJXFTJC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |