C29H28O2 — CID 20743757
2-benzyl-6-[(3-benzyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol (PubChem CID 20743757) has the molecular formula C29H28O2 and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-benzyl-6-[(3-benzyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol.
| Compound Name | 2-benzyl-6-[(3-benzyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol |
|---|---|
| PubChem CID | 20743757 |
| Molecular Formula | C29H28O2 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 2-benzyl-6-[(3-benzyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol |
| SMILES | Cc1cc(Cc2ccccc2)c(O)c(Cc2cc(C)c(O)c(Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C29H28O2/c1-20-13-25(16-22-9-5-3-6-10-22)29(31)26(14-20)18-24-15-21(2)28(30)27(19-24)17-23-11-7-4-8-12-23/h3-15,19,30-31H,16-18H2,1-2H3 |
| InChIKey | HGOASIMJYFLWKJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |