C16H18O2 — CID 22278094
4-[(2-hydroxy-3-methylphenyl)methyl]-2,6-dimethylphenol (PubChem CID 22278094) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-[(2-hydroxy-3-methylphenyl)methyl]-2,6-dimethylphenol.
| Compound Name | 4-[(2-hydroxy-3-methylphenyl)methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 22278094 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 4-[(2-hydroxy-3-methylphenyl)methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(Cc2cccc(C)c2O)cc(C)c1O |
| InChI | InChI=1S/C16H18O2/c1-10-5-4-6-14(16(10)18)9-13-7-11(2)15(17)12(3)8-13/h4-8,17-18H,9H2,1-3H3 |
| InChIKey | PNEWNVFSLCPRAV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |