C27H32O3 — CID 134464799
2,6-bis[(3-ethyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol (PubChem CID 134464799) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2,6-bis[(3-ethyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol.
| Compound Name | 2,6-bis[(3-ethyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol |
|---|---|
| PubChem CID | 134464799 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2,6-bis[(3-ethyl-4-hydroxy-5-methylphenyl)methyl]-4-methylphenol |
| SMILES | CCc1cc(Cc2cc(C)cc(Cc3cc(C)c(O)c(CC)c3)c2O)cc(C)c1O |
| InChI | InChI=1S/C27H32O3/c1-6-21-12-19(10-17(4)25(21)28)14-23-8-16(3)9-24(27(23)30)15-20-11-18(5)26(29)22(7-2)13-20/h8-13,28-30H,6-7,14-15H2,1-5H3 |
| InChIKey | WMOOWSAGOUIUGG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |