C21H28O2 — CID 22999667
4-[(3,5-diethyl-4-hydroxyphenyl)methyl]-2,6-diethylphenol (PubChem CID 22999667) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 4-[(3,5-diethyl-4-hydroxyphenyl)methyl]-2,6-diethylphenol.
| Compound Name | 4-[(3,5-diethyl-4-hydroxyphenyl)methyl]-2,6-diethylphenol |
|---|---|
| PubChem CID | 22999667 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 4-[(3,5-diethyl-4-hydroxyphenyl)methyl]-2,6-diethylphenol |
| SMILES | CCc1cc(Cc2cc(CC)c(O)c(CC)c2)cc(CC)c1O |
| InChI | InChI=1S/C21H28O2/c1-5-16-10-14(11-17(6-2)20(16)22)9-15-12-18(7-3)21(23)19(8-4)13-15/h10-13,22-23H,5-9H2,1-4H3 |
| InChIKey | JCURXVHMYGGRLO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |