C15H24O — CID 66879488
2,6-diethyl-4-pentylphenol (PubChem CID 66879488) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2,6-diethyl-4-pentylphenol.
| Compound Name | 2,6-diethyl-4-pentylphenol |
|---|---|
| PubChem CID | 66879488 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2,6-diethyl-4-pentylphenol |
| SMILES | CCCCCc1cc(CC)c(O)c(CC)c1 |
| InChI | InChI=1S/C15H24O/c1-4-7-8-9-12-10-13(5-2)15(16)14(6-3)11-12/h10-11,16H,4-9H2,1-3H3 |
| InChIKey | LPVCACGMEHZJOY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|