C18H30Cl2OZr — CID 174692892
2,4,6-tributylphenol;zirconium(2+);dichloride (PubChem CID 174692892) has the molecular formula C18H30Cl2OZr and a molecular weight of 424.57 g/mol. Its IUPAC name is 2,4,6-tributylphenol;zirconium(2+);dichloride.
| Compound Name | 2,4,6-tributylphenol;zirconium(2+);dichloride |
|---|---|
| PubChem CID | 174692892 |
| Molecular Formula | C18H30Cl2OZr |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 2,4,6-tributylphenol;zirconium(2+);dichloride |
| SMILES | CCCCc1cc(CCCC)c(O)c(CCCC)c1.[Cl-].[Cl-].[Zr+2] |
| InChI | InChI=1S/C18H30O.2ClH.Zr/c1-4-7-10-15-13-16(11-8-5-2)18(19)17(14-15)12-9-6-3;;;/h13-14,19H,4-12H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | DKBAZIPXXHNWKF-UHFFFAOYSA-L |
| XLogP | -0.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |