C53H55O3P — CID 153401435
4-[[3-[(4-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-2-(tetrabenzyl-λ5-phosphanyl)oxyphenyl]methyl]-2,6-dimethylphenol (PubChem CID 153401435) has the molecular formula C53H55O3P and a molecular weight of 770.99 g/mol. Its IUPAC name is 4-[[3-[(4-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-2-(tetrabenzyl-λ5-phosphanyl)oxyphenyl]methyl]-2,6-dimethylphenol.
| Compound Name | 4-[[3-[(4-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-2-(tetrabenzyl-λ5-phosphanyl)oxyphenyl]methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 153401435 |
| Molecular Formula | C53H55O3P |
| Molecular Weight | 770.99 g/mol |
| Exact Mass | 770.39 |
| IUPAC Name | 4-[[3-[(4-hydroxy-3,5-dimethylphenyl)methyl]-5-methyl-2-(tetrabenzyl-λ5-phosphanyl)oxyphenyl]methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(Cc2cc(C)c(O)c(C)c2)c(OP(Cc2ccccc2)(Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)c(Cc2cc(C)c(O)c(C)c2)c1 |
| InChI | InChI=1S/C53H55O3P/c1-38-26-49(32-47-28-39(2)51(54)40(3)29-47)53(50(27-38)33-48-30-41(4)52(55)42(5)31-48)56-57(34-43-18-10-6-11-19-43,35-44-20-12-7-13-21-44,36-45-22-14-8-15-23-45)37-46-24-16-9-17-25-46/h6-31,54-55H,32-37H2,1-5H3 |
| InChIKey | DYVNEFLMPLDJQY-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.99 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|