C9H11ClO3S — CID 117341424
(2-hydroxy-3,5-dimethylphenyl)methanesulfonyl chloride (PubChem CID 117341424) has the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. Its IUPAC name is (2-hydroxy-3,5-dimethylphenyl)methanesulfonyl chloride.
| Compound Name | (2-hydroxy-3,5-dimethylphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 117341424 |
| Molecular Formula | C9H11ClO3S |
| Molecular Weight | 234.70 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | (2-hydroxy-3,5-dimethylphenyl)methanesulfonyl chloride |
| SMILES | Cc1cc(C)c(O)c(CS(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C9H11ClO3S/c1-6-3-7(2)9(11)8(4-6)5-14(10,12)13/h3-4,11H,5H2,1-2H3 |
| InChIKey | USOKDRLGIHQDBS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.70 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |