C9H10Cl2O2S — CID 84707894
(5-chloro-2,3-dimethylphenyl)methanesulfonyl chloride (PubChem CID 84707894) has the molecular formula C9H10Cl2O2S and a molecular weight of 253.15 g/mol. Its IUPAC name is (5-chloro-2,3-dimethylphenyl)methanesulfonyl chloride.
| Compound Name | (5-chloro-2,3-dimethylphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 84707894 |
| Molecular Formula | C9H10Cl2O2S |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | (5-chloro-2,3-dimethylphenyl)methanesulfonyl chloride |
| SMILES | Cc1cc(Cl)cc(CS(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C9H10Cl2O2S/c1-6-3-9(10)4-8(7(6)2)5-14(11,12)13/h3-4H,5H2,1-2H3 |
| InChIKey | HSVBOKDJLIJHNK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |