C9H10ClFO2S — CID 84798329
(3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride (PubChem CID 84798329) has the molecular formula C9H10ClFO2S and a molecular weight of 236.69 g/mol. Its IUPAC name is (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride.
| Compound Name | (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 84798329 |
| Molecular Formula | C9H10ClFO2S |
| Molecular Weight | 236.69 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride |
| SMILES | Cc1cc(CS(=O)(=O)Cl)cc(F)c1C |
| InChI | InChI=1S/C9H10ClFO2S/c1-6-3-8(5-14(10,12)13)4-9(11)7(6)2/h3-4H,5H2,1-2H3 |
| InChIKey | NAYSRARNWKATJT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |