(3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride

C9H10ClFO2S — CID 84798329

IUPAC(3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride
SMILESCc1cc(CS(=O)(=O)Cl)cc(F)c1C
InChIInChI=1S/C9H10ClFO2S/c1-6-3-8(5-14(10,12)13)4-9(11)7(6)2/h3-4H,5H2,1-2H3
InChIKeyNAYSRARNWKATJT-UHFFFAOYSA-N
MW236.69 g/mol
LogP2.51
Rot. Bonds2

About (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride

(3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride (PubChem CID 84798329) has the molecular formula C9H10ClFO2S and a molecular weight of 236.69 g/mol. Its IUPAC name is (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride.

Molecular Properties

Compound Name(3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride
PubChem CID84798329
Molecular FormulaC9H10ClFO2S
Molecular Weight236.69 g/mol
Exact Mass236.01
IUPAC Name(3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride
SMILESCc1cc(CS(=O)(=O)Cl)cc(F)c1C
InChIInChI=1S/C9H10ClFO2S/c1-6-3-8(5-14(10,12)13)4-9(11)7(6)2/h3-4H,5H2,1-2H3
InChIKeyNAYSRARNWKATJT-UHFFFAOYSA-N
XLogP2.51
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.69
LogP ≤ 52.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride?
The IUPAC name of (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride (CID 84798329) is (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride.
What is the SMILES notation for (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride?
The canonical SMILES for (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride is Cc1cc(CS(=O)(=O)Cl)cc(F)c1C.
What is the InChIKey of (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride?
The InChIKey is NAYSRARNWKATJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClFO2S/c1-6-3-8(5-14(10,12)13)4-9(11)7(6)2/h3-4H,5H2,1-2H3.
What are the key properties of (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride?
(3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride has a molecular weight of 236.69 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-4,5-dimethylphenyl)methanesulfonyl chloride is sourced from PubChem (CID 84798329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).