C8H7ClF2O3S — CID 84805414
(3,4-difluoro-5-methoxyphenyl)methanesulfonyl chloride (PubChem CID 84805414) has the molecular formula C8H7ClF2O3S and a molecular weight of 256.66 g/mol. Its IUPAC name is (3,4-difluoro-5-methoxyphenyl)methanesulfonyl chloride.
| Compound Name | (3,4-difluoro-5-methoxyphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 84805414 |
| Molecular Formula | C8H7ClF2O3S |
| Molecular Weight | 256.66 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | (3,4-difluoro-5-methoxyphenyl)methanesulfonyl chloride |
| SMILES | COc1cc(CS(=O)(=O)Cl)cc(F)c1F |
| InChI | InChI=1S/C8H7ClF2O3S/c1-14-7-3-5(4-15(9,12)13)2-6(10)8(7)11/h2-3H,4H2,1H3 |
| InChIKey | QTWKCAMZFYQXQT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.66 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |