C8H6Cl2F2O3S — CID 117469959
(4-chloro-3,5-difluoro-2-methoxyphenyl)methanesulfonyl chloride (PubChem CID 117469959) has the molecular formula C8H6Cl2F2O3S and a molecular weight of 291.10 g/mol. Its IUPAC name is (4-chloro-3,5-difluoro-2-methoxyphenyl)methanesulfonyl chloride.
| Compound Name | (4-chloro-3,5-difluoro-2-methoxyphenyl)methanesulfonyl chloride |
|---|---|
| PubChem CID | 117469959 |
| Molecular Formula | C8H6Cl2F2O3S |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | (4-chloro-3,5-difluoro-2-methoxyphenyl)methanesulfonyl chloride |
| SMILES | COc1c(CS(=O)(=O)Cl)cc(F)c(Cl)c1F |
| InChI | InChI=1S/C8H6Cl2F2O3S/c1-15-8-4(3-16(10,13)14)2-5(11)6(9)7(8)12/h2H,3H2,1H3 |
| InChIKey | VMYYPZVGXYBACB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|