About (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride
(3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride (PubChem CID 117498210) has the molecular formula C11H14Cl2O4S
and a molecular weight of 313.20 g/mol. Its IUPAC name is (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride.
Analyze (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride?
The IUPAC name of (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride (CID 117498210) is (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride.
What is the SMILES notation for (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride?
The canonical SMILES for (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride is CCc1c(CS(=O)(=O)Cl)cc(OC)c(OC)c1Cl.
What is the InChIKey of (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride?
The InChIKey is CGIKHOTVJPTZNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2O4S/c1-4-8-7(6-18(13,14)15)5-9(16-2)11(17-3)10(8)12/h5H,4,6H2,1-3H3.
What are the key properties of (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride?
(3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride has a molecular weight of 313.20 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-2-ethyl-4,5-dimethoxyphenyl)methanesulfonyl chloride is sourced from PubChem (CID 117498210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).