C13H20O3 — CID 123966014
1,2-diethyl-3,4,5-trimethoxybenzene (PubChem CID 123966014) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1,2-diethyl-3,4,5-trimethoxybenzene.
| Compound Name | 1,2-diethyl-3,4,5-trimethoxybenzene |
|---|---|
| PubChem CID | 123966014 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1,2-diethyl-3,4,5-trimethoxybenzene |
| SMILES | CCc1cc(OC)c(OC)c(OC)c1CC |
| InChI | InChI=1S/C13H20O3/c1-6-9-8-11(14-3)13(16-5)12(15-4)10(9)7-2/h8H,6-7H2,1-5H3 |
| InChIKey | MOIADVYWXHIKFB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |