C12H15NO2 — CID 14346520
2-(2-ethyl-3,4-dimethoxyphenyl)acetonitrile (PubChem CID 14346520) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(2-ethyl-3,4-dimethoxyphenyl)acetonitrile.
| Compound Name | 2-(2-ethyl-3,4-dimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 14346520 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(2-ethyl-3,4-dimethoxyphenyl)acetonitrile |
| SMILES | CCc1c(CC#N)ccc(OC)c1OC |
| InChI | InChI=1S/C12H15NO2/c1-4-10-9(7-8-13)5-6-11(14-2)12(10)15-3/h5-6H,4,7H2,1-3H3 |
| InChIKey | IXLWQMSHKLTIAI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |