C12H19NO3 — CID 117323985
1-(6-ethyl-2,3-dimethoxyphenyl)-N-methoxymethanamine (PubChem CID 117323985) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-(6-ethyl-2,3-dimethoxyphenyl)-N-methoxymethanamine.
| Compound Name | 1-(6-ethyl-2,3-dimethoxyphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117323985 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 1-(6-ethyl-2,3-dimethoxyphenyl)-N-methoxymethanamine |
| SMILES | CCc1ccc(OC)c(OC)c1CNOC |
| InChI | InChI=1S/C12H19NO3/c1-5-9-6-7-11(14-2)12(15-3)10(9)8-13-16-4/h6-7,13H,5,8H2,1-4H3 |
| InChIKey | SHVQXJGVYVFIBL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|