C11H13NO2S — CID 142641031
1-ethyl-2-isothiocyanato-3,4-dimethoxybenzene (PubChem CID 142641031) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 1-ethyl-2-isothiocyanato-3,4-dimethoxybenzene.
| Compound Name | 1-ethyl-2-isothiocyanato-3,4-dimethoxybenzene |
|---|---|
| PubChem CID | 142641031 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 1-ethyl-2-isothiocyanato-3,4-dimethoxybenzene |
| SMILES | CCc1ccc(OC)c(OC)c1N=C=S |
| InChI | InChI=1S/C11H13NO2S/c1-4-8-5-6-9(13-2)11(14-3)10(8)12-7-15/h5-6H,4H2,1-3H3 |
| InChIKey | SDIWZMWCKVRXPJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|