C10H14O3S — CID 146288940
1-ethyl-3-hydroxysulfanyl-2,4-dimethoxybenzene (PubChem CID 146288940) has the molecular formula C10H14O3S and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-ethyl-3-hydroxysulfanyl-2,4-dimethoxybenzene.
| Compound Name | 1-ethyl-3-hydroxysulfanyl-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 146288940 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1-ethyl-3-hydroxysulfanyl-2,4-dimethoxybenzene |
| SMILES | CCc1ccc(OC)c(SO)c1OC |
| InChI | InChI=1S/C10H14O3S/c1-4-7-5-6-8(12-2)10(14-11)9(7)13-3/h5-6,11H,4H2,1-3H3 |
| InChIKey | AHYOJPRKSSVOOZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|