C12H19NO2S — CID 69397655
1-(2,4-dimethoxy-3-methylsulfanylphenyl)propan-2-amine (PubChem CID 69397655) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 1-(2,4-dimethoxy-3-methylsulfanylphenyl)propan-2-amine.
| Compound Name | 1-(2,4-dimethoxy-3-methylsulfanylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 69397655 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-(2,4-dimethoxy-3-methylsulfanylphenyl)propan-2-amine |
| SMILES | COc1ccc(CC(C)N)c(OC)c1SC |
| InChI | InChI=1S/C12H19NO2S/c1-8(13)7-9-5-6-10(14-2)12(16-4)11(9)15-3/h5-6,8H,7,13H2,1-4H3 |
| InChIKey | JSAZVDUERDHQOT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |