C10H15NO3S — CID 117330895
O-[(2,4-dimethoxy-3-methylsulfanylphenyl)methyl]hydroxylamine (PubChem CID 117330895) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is O-[(2,4-dimethoxy-3-methylsulfanylphenyl)methyl]hydroxylamine.
| Compound Name | O-[(2,4-dimethoxy-3-methylsulfanylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117330895 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | O-[(2,4-dimethoxy-3-methylsulfanylphenyl)methyl]hydroxylamine |
| SMILES | COc1ccc(CON)c(OC)c1SC |
| InChI | InChI=1S/C10H15NO3S/c1-12-8-5-4-7(6-14-11)9(13-2)10(8)15-3/h4-5H,6,11H2,1-3H3 |
| InChIKey | WQPNZBPFSOQUEP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|