C11H17NO4 — CID 117326901
O-[[2,3-dimethoxy-4-(methoxymethyl)phenyl]methyl]hydroxylamine (PubChem CID 117326901) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is O-[[2,3-dimethoxy-4-(methoxymethyl)phenyl]methyl]hydroxylamine.
| Compound Name | O-[[2,3-dimethoxy-4-(methoxymethyl)phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 117326901 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | O-[[2,3-dimethoxy-4-(methoxymethyl)phenyl]methyl]hydroxylamine |
| SMILES | COCc1ccc(CON)c(OC)c1OC |
| InChI | InChI=1S/C11H17NO4/c1-13-6-8-4-5-9(7-16-12)11(15-3)10(8)14-2/h4-5H,6-7,12H2,1-3H3 |
| InChIKey | PRMCDLFHRAEJEI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|