C10H14FNO2 — CID 117288503
O-[(5-fluoro-3-methoxy-2,4-dimethylphenyl)methyl]hydroxylamine (PubChem CID 117288503) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is O-[(5-fluoro-3-methoxy-2,4-dimethylphenyl)methyl]hydroxylamine.
| Compound Name | O-[(5-fluoro-3-methoxy-2,4-dimethylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117288503 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | O-[(5-fluoro-3-methoxy-2,4-dimethylphenyl)methyl]hydroxylamine |
| SMILES | COc1c(C)c(F)cc(CON)c1C |
| InChI | InChI=1S/C10H14FNO2/c1-6-8(5-14-12)4-9(11)7(2)10(6)13-3/h4H,5,12H2,1-3H3 |
| InChIKey | TYVGPLYTGAXRDO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|