C10H14ClNO3 — CID 117335488
O-[(3-chloro-2,4-dimethoxy-5-methylphenyl)methyl]hydroxylamine (PubChem CID 117335488) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is O-[(3-chloro-2,4-dimethoxy-5-methylphenyl)methyl]hydroxylamine.
| Compound Name | O-[(3-chloro-2,4-dimethoxy-5-methylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117335488 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | O-[(3-chloro-2,4-dimethoxy-5-methylphenyl)methyl]hydroxylamine |
| SMILES | COc1c(C)cc(CON)c(OC)c1Cl |
| InChI | InChI=1S/C10H14ClNO3/c1-6-4-7(5-15-12)10(14-3)8(11)9(6)13-2/h4H,5,12H2,1-3H3 |
| InChIKey | PJCYYAMPXLZIPT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|