C13H20ClNO2 — CID 117398141
4-(3-chloro-2,4-dimethoxy-5-methylphenyl)butan-1-amine (PubChem CID 117398141) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 4-(3-chloro-2,4-dimethoxy-5-methylphenyl)butan-1-amine.
| Compound Name | 4-(3-chloro-2,4-dimethoxy-5-methylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 117398141 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-(3-chloro-2,4-dimethoxy-5-methylphenyl)butan-1-amine |
| SMILES | COc1c(C)cc(CCCCN)c(OC)c1Cl |
| InChI | InChI=1S/C13H20ClNO2/c1-9-8-10(6-4-5-7-15)13(17-3)11(14)12(9)16-2/h8H,4-7,15H2,1-3H3 |
| InChIKey | ZNGZDQHSQUKOKJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|