C14H22ClN — CID 115485082
6-(2-chloro-4,5-dimethylphenyl)hexan-1-amine (PubChem CID 115485082) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is 6-(2-chloro-4,5-dimethylphenyl)hexan-1-amine.
| Compound Name | 6-(2-chloro-4,5-dimethylphenyl)hexan-1-amine |
|---|---|
| PubChem CID | 115485082 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 6-(2-chloro-4,5-dimethylphenyl)hexan-1-amine |
| SMILES | Cc1cc(Cl)c(CCCCCCN)cc1C |
| InChI | InChI=1S/C14H22ClN/c1-11-9-13(14(15)10-12(11)2)7-5-3-4-6-8-16/h9-10H,3-8,16H2,1-2H3 |
| InChIKey | VIBIQSSVNBMELY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|