C12H18ClNO — CID 117328034
3-(3-chloro-2-methoxy-4,6-dimethylphenyl)propan-1-amine (PubChem CID 117328034) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is 3-(3-chloro-2-methoxy-4,6-dimethylphenyl)propan-1-amine.
| Compound Name | 3-(3-chloro-2-methoxy-4,6-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 117328034 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3-(3-chloro-2-methoxy-4,6-dimethylphenyl)propan-1-amine |
| SMILES | COc1c(Cl)c(C)cc(C)c1CCCN |
| InChI | InChI=1S/C12H18ClNO/c1-8-7-9(2)11(13)12(15-3)10(8)5-4-6-14/h7H,4-6,14H2,1-3H3 |
| InChIKey | GHOHVEADHRNKSO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |