C12H18ClNO2 — CID 117361457
3-(4-chloro-2,3-dimethoxy-6-methylphenyl)propan-1-amine (PubChem CID 117361457) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 3-(4-chloro-2,3-dimethoxy-6-methylphenyl)propan-1-amine.
| Compound Name | 3-(4-chloro-2,3-dimethoxy-6-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 117361457 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-(4-chloro-2,3-dimethoxy-6-methylphenyl)propan-1-amine |
| SMILES | COc1c(Cl)cc(C)c(CCCN)c1OC |
| InChI | InChI=1S/C12H18ClNO2/c1-8-7-10(13)12(16-3)11(15-2)9(8)5-4-6-14/h7H,4-6,14H2,1-3H3 |
| InChIKey | LADWYMNSGAEHOH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |