C13H20BrNO — CID 117461386
4-(3-bromo-2-methoxy-4,6-dimethylphenyl)butan-1-amine (PubChem CID 117461386) has the molecular formula C13H20BrNO and a molecular weight of 286.21 g/mol. Its IUPAC name is 4-(3-bromo-2-methoxy-4,6-dimethylphenyl)butan-1-amine.
| Compound Name | 4-(3-bromo-2-methoxy-4,6-dimethylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 117461386 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-(3-bromo-2-methoxy-4,6-dimethylphenyl)butan-1-amine |
| SMILES | COc1c(Br)c(C)cc(C)c1CCCCN |
| InChI | InChI=1S/C13H20BrNO/c1-9-8-10(2)12(14)13(16-3)11(9)6-4-5-7-15/h8H,4-7,15H2,1-3H3 |
| InChIKey | FWOACBQZTJDCCJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|