C12H17BrFNO2 — CID 117491322
4-(2-bromo-3-fluoro-5,6-dimethoxyphenyl)butan-1-amine (PubChem CID 117491322) has the molecular formula C12H17BrFNO2 and a molecular weight of 306.18 g/mol. Its IUPAC name is 4-(2-bromo-3-fluoro-5,6-dimethoxyphenyl)butan-1-amine.
| Compound Name | 4-(2-bromo-3-fluoro-5,6-dimethoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 117491322 |
| Molecular Formula | C12H17BrFNO2 |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 4-(2-bromo-3-fluoro-5,6-dimethoxyphenyl)butan-1-amine |
| SMILES | COc1cc(F)c(Br)c(CCCCN)c1OC |
| InChI | InChI=1S/C12H17BrFNO2/c1-16-10-7-9(14)11(13)8(12(10)17-2)5-3-4-6-15/h7H,3-6,15H2,1-2H3 |
| InChIKey | NUAWBGREMSMROJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|