C24H34Cl2N2O4 — CID 10390646
3-[10-(3-aminopropyl)-2,3,6,7-tetramethoxyanthracen-9-yl]propan-1-amine;dihydrochloride (PubChem CID 10390646) has the molecular formula C24H34Cl2N2O4 and a molecular weight of 485.45 g/mol. Its IUPAC name is 3-[10-(3-aminopropyl)-2,3,6,7-tetramethoxyanthracen-9-yl]propan-1-amine;dihydrochloride.
| Compound Name | 3-[10-(3-aminopropyl)-2,3,6,7-tetramethoxyanthracen-9-yl]propan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 10390646 |
| Molecular Formula | C24H34Cl2N2O4 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 3-[10-(3-aminopropyl)-2,3,6,7-tetramethoxyanthracen-9-yl]propan-1-amine;dihydrochloride |
| SMILES | COc1cc2c(CCCN)c3cc(OC)c(OC)cc3c(CCCN)c2cc1OC.Cl.Cl |
| InChI | InChI=1S/C24H32N2O4.2ClH/c1-27-21-11-17-15(7-5-9-25)19-13-23(29-3)24(30-4)14-20(19)16(8-6-10-26)18(17)12-22(21)28-2;;/h11-14H,5-10,25-26H2,1-4H3;2*1H |
| InChIKey | DWRXABCQFURSES-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|