C11H16FNO2 — CID 117304223
3-(6-fluoro-2,3-dimethoxyphenyl)propan-1-amine (PubChem CID 117304223) has the molecular formula C11H16FNO2 and a molecular weight of 213.25 g/mol. Its IUPAC name is 3-(6-fluoro-2,3-dimethoxyphenyl)propan-1-amine.
| Compound Name | 3-(6-fluoro-2,3-dimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 117304223 |
| Molecular Formula | C11H16FNO2 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-(6-fluoro-2,3-dimethoxyphenyl)propan-1-amine |
| SMILES | COc1ccc(F)c(CCCN)c1OC |
| InChI | InChI=1S/C11H16FNO2/c1-14-10-6-5-9(12)8(4-3-7-13)11(10)15-2/h5-6H,3-4,7,13H2,1-2H3 |
| InChIKey | MONYWHUDNDMSLO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |