C11H16ClNO2 — CID 84793335
3-(2-chloro-3,6-dimethoxyphenyl)propan-1-amine (PubChem CID 84793335) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 3-(2-chloro-3,6-dimethoxyphenyl)propan-1-amine.
| Compound Name | 3-(2-chloro-3,6-dimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 84793335 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-(2-chloro-3,6-dimethoxyphenyl)propan-1-amine |
| SMILES | COc1ccc(OC)c(CCCN)c1Cl |
| InChI | InChI=1S/C11H16ClNO2/c1-14-9-5-6-10(15-2)11(12)8(9)4-3-7-13/h5-6H,3-4,7,13H2,1-2H3 |
| InChIKey | ZVBMADGYIAKFGM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |