C10H12ClF2NO — CID 84797782
3-(3-chloro-2,4-difluoro-6-methoxyphenyl)propan-1-amine (PubChem CID 84797782) has the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. Its IUPAC name is 3-(3-chloro-2,4-difluoro-6-methoxyphenyl)propan-1-amine.
| Compound Name | 3-(3-chloro-2,4-difluoro-6-methoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 84797782 |
| Molecular Formula | C10H12ClF2NO |
| Molecular Weight | 235.66 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-(3-chloro-2,4-difluoro-6-methoxyphenyl)propan-1-amine |
| SMILES | COc1cc(F)c(Cl)c(F)c1CCCN |
| InChI | InChI=1S/C10H12ClF2NO/c1-15-8-5-7(12)9(11)10(13)6(8)3-2-4-14/h5H,2-4,14H2,1H3 |
| InChIKey | QUYKURATLLDFMW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|