C8H8F3NO — CID 117282112
(2,3,6-trifluoro-5-methoxyphenyl)methanamine (PubChem CID 117282112) has the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. Its IUPAC name is (2,3,6-trifluoro-5-methoxyphenyl)methanamine.
| Compound Name | (2,3,6-trifluoro-5-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 117282112 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (2,3,6-trifluoro-5-methoxyphenyl)methanamine |
| SMILES | COc1cc(F)c(F)c(CN)c1F |
| InChI | InChI=1S/C8H8F3NO/c1-13-6-2-5(9)7(10)4(3-12)8(6)11/h2H,3,12H2,1H3 |
| InChIKey | NYWXLXQIXMCFFO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|