C10H10F3NO2 — CID 117337381
3-amino-1-(2,3,6-trifluoro-5-methoxyphenyl)propan-1-one (PubChem CID 117337381) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 3-amino-1-(2,3,6-trifluoro-5-methoxyphenyl)propan-1-one.
| Compound Name | 3-amino-1-(2,3,6-trifluoro-5-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 117337381 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-amino-1-(2,3,6-trifluoro-5-methoxyphenyl)propan-1-one |
| SMILES | COc1cc(F)c(F)c(C(=O)CCN)c1F |
| InChI | InChI=1S/C10H10F3NO2/c1-16-7-4-5(11)9(12)8(10(7)13)6(15)2-3-14/h4H,2-3,14H2,1H3 |
| InChIKey | FTTLXCDLORZQHI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|