C9H8F3NO — CID 131141781
3-amino-1-(3,4,5-trifluorophenyl)propan-1-one (PubChem CID 131141781) has the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. Its IUPAC name is 3-amino-1-(3,4,5-trifluorophenyl)propan-1-one.
| Compound Name | 3-amino-1-(3,4,5-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 131141781 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 3-amino-1-(3,4,5-trifluorophenyl)propan-1-one |
| SMILES | NCCC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C9H8F3NO/c10-6-3-5(8(14)1-2-13)4-7(11)9(6)12/h3-4H,1-2,13H2 |
| InChIKey | YXXQAAZFPLWIRG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|