C12H12F3NO3 — CID 175019847
[(2S)-5-oxo-5-(3,4,5-trifluorophenyl)pentan-2-yl] carbamate (PubChem CID 175019847) has the molecular formula C12H12F3NO3 and a molecular weight of 275.23 g/mol. Its IUPAC name is [(2S)-5-oxo-5-(3,4,5-trifluorophenyl)pentan-2-yl] carbamate.
| Compound Name | [(2S)-5-oxo-5-(3,4,5-trifluorophenyl)pentan-2-yl] carbamate |
|---|---|
| PubChem CID | 175019847 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | [(2S)-5-oxo-5-(3,4,5-trifluorophenyl)pentan-2-yl] carbamate |
| SMILES | C[C@@H](CCC(=O)c1cc(F)c(F)c(F)c1)OC(N)=O |
| InChI | InChI=1S/C12H12F3NO3/c1-6(19-12(16)18)2-3-10(17)7-4-8(13)11(15)9(14)5-7/h4-6H,2-3H2,1H3,(H2,16,18)/t6-/m0/s1 |
| InChIKey | GWDLRUOIZBVOHE-LURJTMIESA-N |
| XLogP | 2.55 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|