C18H22F3NO5 — CID 67372607
ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(3,4,5-trifluorophenyl)pentanoate (PubChem CID 67372607) has the molecular formula C18H22F3NO5 and a molecular weight of 389.37 g/mol. Its IUPAC name is ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(3,4,5-trifluorophenyl)pentanoate.
| Compound Name | ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(3,4,5-trifluorophenyl)pentanoate |
|---|---|
| PubChem CID | 67372607 |
| Molecular Formula | C18H22F3NO5 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | ethyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(3,4,5-trifluorophenyl)pentanoate |
| SMILES | CCOC(=O)[C@@H](CCC(=O)c1cc(F)c(F)c(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22F3NO5/c1-5-26-16(24)13(22-17(25)27-18(2,3)4)6-7-14(23)10-8-11(19)15(21)12(20)9-10/h8-9,13H,5-7H2,1-4H3,(H,22,25)/t13-/m1/s1 |
| InChIKey | YNHVZEBBEODKAH-CYBMUJFWSA-N |
| XLogP | 3.52 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|