C14H15F2NO5 — CID 141172686
[5-(3,4-difluorophenyl)-1-ethoxy-1,5-dioxopentan-2-yl]carbamic acid (PubChem CID 141172686) has the molecular formula C14H15F2NO5 and a molecular weight of 315.27 g/mol. Its IUPAC name is [5-(3,4-difluorophenyl)-1-ethoxy-1,5-dioxopentan-2-yl]carbamic acid.
| Compound Name | [5-(3,4-difluorophenyl)-1-ethoxy-1,5-dioxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 141172686 |
| Molecular Formula | C14H15F2NO5 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | [5-(3,4-difluorophenyl)-1-ethoxy-1,5-dioxopentan-2-yl]carbamic acid |
| SMILES | CCOC(=O)C(CCC(=O)c1ccc(F)c(F)c1)NC(=O)O |
| InChI | InChI=1S/C14H15F2NO5/c1-2-22-13(19)11(17-14(20)21)5-6-12(18)8-3-4-9(15)10(16)7-8/h3-4,7,11,17H,2,5-6H2,1H3,(H,20,21) |
| InChIKey | NRGMTJPFRJJFQR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |