C18H22FNO6 — CID 155929769
ethyl (2S)-5-(4-fluorophenyl)-2-[(4-methoxy-4-oxobutanoyl)amino]-5-oxopentanoate (PubChem CID 155929769) has the molecular formula C18H22FNO6 and a molecular weight of 367.37 g/mol. Its IUPAC name is ethyl (2S)-5-(4-fluorophenyl)-2-[(4-methoxy-4-oxobutanoyl)amino]-5-oxopentanoate.
| Compound Name | ethyl (2S)-5-(4-fluorophenyl)-2-[(4-methoxy-4-oxobutanoyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 155929769 |
| Molecular Formula | C18H22FNO6 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | ethyl (2S)-5-(4-fluorophenyl)-2-[(4-methoxy-4-oxobutanoyl)amino]-5-oxopentanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)c1ccc(F)cc1)NC(=O)CCC(=O)OC |
| InChI | InChI=1S/C18H22FNO6/c1-3-26-18(24)14(20-16(22)10-11-17(23)25-2)8-9-15(21)12-4-6-13(19)7-5-12/h4-7,14H,3,8-11H2,1-2H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | BYNOTNVBHRTNRW-AWEZNQCLSA-N |
| XLogP | 1.79 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |