C23H25NO6 — CID 155929763
benzyl (2S)-2-[(4-methoxy-4-oxobutanoyl)amino]-5-oxo-5-phenylpentanoate (PubChem CID 155929763) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is benzyl (2S)-2-[(4-methoxy-4-oxobutanoyl)amino]-5-oxo-5-phenylpentanoate.
| Compound Name | benzyl (2S)-2-[(4-methoxy-4-oxobutanoyl)amino]-5-oxo-5-phenylpentanoate |
|---|---|
| PubChem CID | 155929763 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | benzyl (2S)-2-[(4-methoxy-4-oxobutanoyl)amino]-5-oxo-5-phenylpentanoate |
| SMILES | COC(=O)CCC(=O)N[C@@H](CCC(=O)c1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H25NO6/c1-29-22(27)15-14-21(26)24-19(12-13-20(25)18-10-6-3-7-11-18)23(28)30-16-17-8-4-2-5-9-17/h2-11,19H,12-16H2,1H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | DAYJUSUMNMPUJK-IBGZPJMESA-N |
| XLogP | 2.83 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |