C31H33NO7 — CID 123256099
dibenzyl 2-[(5-oxo-5-phenylmethoxypentanoyl)amino]pentanedioate (PubChem CID 123256099) has the molecular formula C31H33NO7 and a molecular weight of 531.61 g/mol. Its IUPAC name is dibenzyl 2-[(5-oxo-5-phenylmethoxypentanoyl)amino]pentanedioate.
| Compound Name | dibenzyl 2-[(5-oxo-5-phenylmethoxypentanoyl)amino]pentanedioate |
|---|---|
| PubChem CID | 123256099 |
| Molecular Formula | C31H33NO7 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | dibenzyl 2-[(5-oxo-5-phenylmethoxypentanoyl)amino]pentanedioate |
| SMILES | O=C(CCCC(=O)OCc1ccccc1)NC(CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H33NO7/c33-28(17-10-18-29(34)37-21-24-11-4-1-5-12-24)32-27(31(36)39-23-26-15-8-3-9-16-26)19-20-30(35)38-22-25-13-6-2-7-14-25/h1-9,11-16,27H,10,17-23H2,(H,32,33) |
| InChIKey | PHRKCTJGEYQLGL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|